C11H14N2OS — CID 119087334
2-(4-methoxy-1,3-benzothiazol-2-yl)propan-2-amine (PubChem CID 119087334) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 2-(4-methoxy-1,3-benzothiazol-2-yl)propan-2-amine.
| Compound Name | 2-(4-methoxy-1,3-benzothiazol-2-yl)propan-2-amine |
|---|---|
| PubChem CID | 119087334 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-(4-methoxy-1,3-benzothiazol-2-yl)propan-2-amine |
| SMILES | COc1cccc2sc(C(C)(C)N)nc12 |
| InChI | InChI=1S/C11H14N2OS/c1-11(2,12)10-13-9-7(14-3)5-4-6-8(9)15-10/h4-6H,12H2,1-3H3 |
| InChIKey | QBGDCNSDJNSGJF-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |