C14H19N3OS — CID 16849815
2-(4-ethylpiperazin-1-yl)-4-methoxy-1,3-benzothiazole (PubChem CID 16849815) has the molecular formula C14H19N3OS and a molecular weight of 277.39 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-4-methoxy-1,3-benzothiazole.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-4-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 16849815 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-4-methoxy-1,3-benzothiazole |
| SMILES | CCN1CCN(c2nc3c(OC)cccc3s2)CC1 |
| InChI | InChI=1S/C14H19N3OS/c1-3-16-7-9-17(10-8-16)14-15-13-11(18-2)5-4-6-12(13)19-14/h4-6H,3,7-10H2,1-2H3 |
| InChIKey | ZWVCERKGQTWNFF-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |