C12H11N3OS2 — CID 75498214
4-methoxy-N-(1,3-thiazol-5-ylmethyl)-1,3-benzothiazol-2-amine (PubChem CID 75498214) has the molecular formula C12H11N3OS2 and a molecular weight of 277.37 g/mol. Its IUPAC name is 4-methoxy-N-(1,3-thiazol-5-ylmethyl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-methoxy-N-(1,3-thiazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 75498214 |
| Molecular Formula | C12H11N3OS2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | 4-methoxy-N-(1,3-thiazol-5-ylmethyl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cccc2sc(NCc3cncs3)nc12 |
| InChI | InChI=1S/C12H11N3OS2/c1-16-9-3-2-4-10-11(9)15-12(18-10)14-6-8-5-13-7-17-8/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | AGLWYOFVXJZLGB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |