C14H11IN2O3S2 — CID 3376104
4-iodo-N-(4-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide (PubChem CID 3376104) has the molecular formula C14H11IN2O3S2 and a molecular weight of 446.29 g/mol. Its IUPAC name is 4-iodo-N-(4-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-iodo-N-(4-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3376104 |
| Molecular Formula | C14H11IN2O3S2 |
| Molecular Weight | 446.29 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 4-iodo-N-(4-methoxy-1,3-benzothiazol-2-yl)benzenesulfonamide |
| SMILES | COc1cccc2sc(NS(=O)(=O)c3ccc(I)cc3)nc12 |
| InChI | InChI=1S/C14H11IN2O3S2/c1-20-11-3-2-4-12-13(11)16-14(21-12)17-22(18,19)10-7-5-9(15)6-8-10/h2-8H,1H3,(H,16,17) |
| InChIKey | LSGHZDZCGJAFOQ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|