C24H20N4O4S2 — CID 166118756
4-[(2-hydroxy-3-methoxyphenyl)methylamino]-N-([1,3]thiazolo[4,5-f]isoquinolin-2-yl)benzenesulfonamide (PubChem CID 166118756) has the molecular formula C24H20N4O4S2 and a molecular weight of 492.58 g/mol. Its IUPAC name is 4-[(2-hydroxy-3-methoxyphenyl)methylamino]-N-([1,3]thiazolo[4,5-f]isoquinolin-2-yl)benzenesulfonamide.
| Compound Name | 4-[(2-hydroxy-3-methoxyphenyl)methylamino]-N-([1,3]thiazolo[4,5-f]isoquinolin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 166118756 |
| Molecular Formula | C24H20N4O4S2 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | 4-[(2-hydroxy-3-methoxyphenyl)methylamino]-N-([1,3]thiazolo[4,5-f]isoquinolin-2-yl)benzenesulfonamide |
| SMILES | COc1cccc(CNc2ccc(S(=O)(=O)Nc3nc4c(ccc5cnccc54)s3)cc2)c1O |
| InChI | InChI=1S/C24H20N4O4S2/c1-32-20-4-2-3-16(23(20)29)14-26-17-6-8-18(9-7-17)34(30,31)28-24-27-22-19-11-12-25-13-15(19)5-10-21(22)33-24/h2-13,26,29H,14H2,1H3,(H,27,28) |
| InChIKey | AOEXJEUBOSAPIQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|