C22H18ClFN4O4S2 — CID 168960335
N-[4-(4-chloro-3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide (PubChem CID 168960335) has the molecular formula C22H18ClFN4O4S2 and a molecular weight of 521.00 g/mol. Its IUPAC name is N-[4-(4-chloro-3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide.
| Compound Name | N-[4-(4-chloro-3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 168960335 |
| Molecular Formula | C22H18ClFN4O4S2 |
| Molecular Weight | 521.00 g/mol |
| Exact Mass | 520.04 |
| IUPAC Name | N-[4-(4-chloro-3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide |
| SMILES | COc1cccc(CNc2ccc(S(=O)(=O)Nc3nc(-c4ccc(Cl)c(F)c4)cs3)nc2)c1O |
| InChI | InChI=1S/C22H18ClFN4O4S2/c1-32-19-4-2-3-14(21(19)29)10-25-15-6-8-20(26-11-15)34(30,31)28-22-27-18(12-33-22)13-5-7-16(23)17(24)9-13/h2-9,11-12,25,29H,10H2,1H3,(H,27,28) |
| InChIKey | AJHNSPWPYJTPGJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|