C28H21F3N4O4S2 — CID 176575423
N-[4-(3,4-difluorophenyl)-5-(3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide (PubChem CID 176575423) has the molecular formula C28H21F3N4O4S2 and a molecular weight of 598.63 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-5-(3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-5-(3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 176575423 |
| Molecular Formula | C28H21F3N4O4S2 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-5-(3-fluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methylamino]pyridine-2-sulfonamide |
| SMILES | COc1cccc(CNc2ccc(S(=O)(=O)Nc3nc(-c4ccc(F)c(F)c4)c(-c4cccc(F)c4)s3)nc2)c1O |
| InChI | InChI=1S/C28H21F3N4O4S2/c1-39-23-7-3-5-18(26(23)36)14-32-20-9-11-24(33-15-20)41(37,38)35-28-34-25(16-8-10-21(30)22(31)13-16)27(40-28)17-4-2-6-19(29)12-17/h2-13,15,32,36H,14H2,1H3,(H,34,35) |
| InChIKey | HEYXYMPUGQVFPU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|