C28H25F2N5O2S2 — CID 176575550
4-(3,4-difluorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methyl-1H-pyridine-2-thione (PubChem CID 176575550) has the molecular formula C28H25F2N5O2S2 and a molecular weight of 565.67 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methyl-1H-pyridine-2-thione.
| Compound Name | 4-(3,4-difluorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methyl-1H-pyridine-2-thione |
|---|---|
| PubChem CID | 176575550 |
| Molecular Formula | C28H25F2N5O2S2 |
| Molecular Weight | 565.67 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 4-(3,4-difluorophenyl)-5-pyridin-4-yl-1,3-thiazol-2-amine;5-[(2-hydroxy-3-methoxyphenyl)methylamino]-3-methyl-1H-pyridine-2-thione |
| SMILES | COc1cccc(CNc2c[nH]c(=S)c(C)c2)c1O.Nc1nc(-c2ccc(F)c(F)c2)c(-c2ccncc2)s1 |
| InChI | InChI=1S/C14H9F2N3S.C14H16N2O2S/c15-10-2-1-9(7-11(10)16)12-13(20-14(17)19-12)8-3-5-18-6-4-8;1-9-6-11(8-16-14(9)19)15-7-10-4-3-5-12(18-2)13(10)17/h1-7H,(H2,17,19);3-6,8,15,17H,7H2,1-2H3,(H,16,19) |
| InChIKey | IQYUTVWULXSYPH-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.67 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|