C24H24BrF2N4O4S2- — CID 176575546
5-bromo-4-(3,4-difluorophenyl)-1,3-thiazol-2-amine;5-[(2,3-dihydroxyphenyl)methylamino]-3-methylpyridine-2-sulfinate;ethane (PubChem CID 176575546) has the molecular formula C24H24BrF2N4O4S2- and a molecular weight of 614.51 g/mol. Its IUPAC name is 5-bromo-4-(3,4-difluorophenyl)-1,3-thiazol-2-amine;5-[(2,3-dihydroxyphenyl)methylamino]-3-methylpyridine-2-sulfinate;ethane.
| Compound Name | 5-bromo-4-(3,4-difluorophenyl)-1,3-thiazol-2-amine;5-[(2,3-dihydroxyphenyl)methylamino]-3-methylpyridine-2-sulfinate;ethane |
|---|---|
| PubChem CID | 176575546 |
| Molecular Formula | C24H24BrF2N4O4S2- |
| Molecular Weight | 614.51 g/mol |
| Exact Mass | 613.04 |
| IUPAC Name | 5-bromo-4-(3,4-difluorophenyl)-1,3-thiazol-2-amine;5-[(2,3-dihydroxyphenyl)methylamino]-3-methylpyridine-2-sulfinate;ethane |
| SMILES | CC.Cc1cc(NCc2cccc(O)c2O)cnc1S(=O)[O-].Nc1nc(-c2ccc(F)c(F)c2)c(Br)s1 |
| InChI | InChI=1S/C13H14N2O4S.C9H5BrF2N2S.C2H6/c1-8-5-10(7-15-13(8)20(18)19)14-6-9-3-2-4-11(16)12(9)17;10-8-7(14-9(13)15-8)4-1-2-5(11)6(12)3-4;1-2/h2-5,7,14,16-17H,6H2,1H3,(H,18,19);1-3H,(H2,13,14);1-2H3/p-1 |
| InChIKey | QIYNOHSTICZWOQ-UHFFFAOYSA-M |
| XLogP | 6.11 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.51 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|