C24H22F2N4O4S2 — CID 168960301
N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methyl-methylamino]-3-methylpyridine-2-sulfonamide (PubChem CID 168960301) has the molecular formula C24H22F2N4O4S2 and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methyl-methylamino]-3-methylpyridine-2-sulfonamide.
| Compound Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methyl-methylamino]-3-methylpyridine-2-sulfonamide |
|---|---|
| PubChem CID | 168960301 |
| Molecular Formula | C24H22F2N4O4S2 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]-5-[(2-hydroxy-3-methoxyphenyl)methyl-methylamino]-3-methylpyridine-2-sulfonamide |
| SMILES | COc1cccc(CN(C)c2cnc(S(=O)(=O)Nc3nc(-c4ccc(F)c(F)c4)cs3)c(C)c2)c1O |
| InChI | InChI=1S/C24H22F2N4O4S2/c1-14-9-17(30(2)12-16-5-4-6-21(34-3)22(16)31)11-27-23(14)36(32,33)29-24-28-20(13-35-24)15-7-8-18(25)19(26)10-15/h4-11,13,31H,12H2,1-3H3,(H,28,29) |
| InChIKey | FCNXIAVHSVYRQG-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|