C27H25N3O6S2 — CID 166118758
N-(7,8-dimethoxybenzo[e][1,3]benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzenesulfonamide (PubChem CID 166118758) has the molecular formula C27H25N3O6S2 and a molecular weight of 551.65 g/mol. Its IUPAC name is N-(7,8-dimethoxybenzo[e][1,3]benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzenesulfonamide.
| Compound Name | N-(7,8-dimethoxybenzo[e][1,3]benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 166118758 |
| Molecular Formula | C27H25N3O6S2 |
| Molecular Weight | 551.65 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | N-(7,8-dimethoxybenzo[e][1,3]benzothiazol-2-yl)-4-[(2-hydroxy-3-methoxyphenyl)methylamino]benzenesulfonamide |
| SMILES | COc1cc2ccc3sc(NS(=O)(=O)c4ccc(NCc5cccc(OC)c5O)cc4)nc3c2cc1OC |
| InChI | InChI=1S/C27H25N3O6S2/c1-34-21-6-4-5-17(26(21)31)15-28-18-8-10-19(11-9-18)38(32,33)30-27-29-25-20-14-23(36-3)22(35-2)13-16(20)7-12-24(25)37-27/h4-14,28,31H,15H2,1-3H3,(H,29,30) |
| InChIKey | CISBIQYQVXVSFP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.65 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|