About 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate
3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate (PubChem CID 9237115) has the molecular formula C20H15N2O4S2-
and a molecular weight of 411.48 g/mol. Its IUPAC name is 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate.
Molecular Properties
| Compound Name | 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate |
| PubChem CID | 9237115 |
| Molecular Formula | C20H15N2O4S2- |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate |
| SMILES | O=C([O-])CCc1ccc(S(=O)(=O)Nc2nc3c(ccc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C20H16N2O4S2/c23-18(24)12-7-13-5-9-15(10-6-13)28(25,26)22-20-21-19-16-4-2-1-3-14(16)8-11-17(19)27-20/h1-6,8-11H,7,12H2,(H,21,22)(H,23,24)/p-1 |
| InChIKey | BIFYVVKJIGEINP-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 99.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate?
The IUPAC name of 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate (CID 9237115) is 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate.
What is the SMILES notation for 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate?
The canonical SMILES for 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate is O=C([O-])CCc1ccc(S(=O)(=O)Nc2nc3c(ccc4ccccc43)s2)cc1.
What is the InChIKey of 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate?
The InChIKey is BIFYVVKJIGEINP-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H16N2O4S2/c23-18(24)12-7-13-5-9-15(10-6-13)28(25,26)22-20-21-19-16-4-2-1-3-14(16)8-11-17(19)27-20/h1-6,8-11H,7,12H2,(H,21,22)(H,23,24)/p-1.
What are the key properties of 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate?
3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate has a molecular weight of 411.48 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(benzo[e][1,3]benzothiazol-2-ylsulfamoyl)phenyl]propanoate is sourced from PubChem (CID 9237115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).