C20H16N2O3S2 — CID 8781134
N-benzo[e][1,3]benzothiazol-2-yl-4-(methylsulfonylmethyl)benzamide (PubChem CID 8781134) has the molecular formula C20H16N2O3S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-4-(methylsulfonylmethyl)benzamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-4-(methylsulfonylmethyl)benzamide |
|---|---|
| PubChem CID | 8781134 |
| Molecular Formula | C20H16N2O3S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-4-(methylsulfonylmethyl)benzamide |
| SMILES | CS(=O)(=O)Cc1ccc(C(=O)Nc2nc3c(ccc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C20H16N2O3S2/c1-27(24,25)12-13-6-8-15(9-7-13)19(23)22-20-21-18-16-5-3-2-4-14(16)10-11-17(18)26-20/h2-11H,12H2,1H3,(H,21,22,23) |
| InChIKey | UJAPIPRCCBPWOC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |