C16H16N2OS — CID 2340220
N-benzo[e][1,3]benzothiazol-2-yl-2,2-dimethylpropanamide (PubChem CID 2340220) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-2,2-dimethylpropanamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2340220 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C16H16N2OS/c1-16(2,3)14(19)18-15-17-13-11-7-5-4-6-10(11)8-9-12(13)20-15/h4-9H,1-3H3,(H,17,18,19) |
| InChIKey | QEHYWLKJIQVQLT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |