C22H20N2O4S — CID 8781141
N-benzo[e][1,3]benzothiazol-2-yl-2-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 8781141) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-2-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-2-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8781141 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-2-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(CC(=O)Nc2nc3c(ccc4ccccc43)s2)cc(OC)c1OC |
| InChI | InChI=1S/C22H20N2O4S/c1-26-16-10-13(11-17(27-2)21(16)28-3)12-19(25)23-22-24-20-15-7-5-4-6-14(15)8-9-18(20)29-22/h4-11H,12H2,1-3H3,(H,23,24,25) |
| InChIKey | DGAHHFKCFOKVTQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |