C21H16N2O2S — CID 2449449
(E)-N-benzo[e][1,3]benzothiazol-2-yl-3-(2-methoxyphenyl)prop-2-enamide (PubChem CID 2449449) has the molecular formula C21H16N2O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is (E)-N-benzo[e][1,3]benzothiazol-2-yl-3-(2-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-benzo[e][1,3]benzothiazol-2-yl-3-(2-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2449449 |
| Molecular Formula | C21H16N2O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | (E)-N-benzo[e][1,3]benzothiazol-2-yl-3-(2-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccccc1/C=C/C(=O)Nc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C21H16N2O2S/c1-25-17-9-5-3-7-15(17)11-13-19(24)22-21-23-20-16-8-4-2-6-14(16)10-12-18(20)26-21/h2-13H,1H3,(H,22,23,24)/b13-11+ |
| InChIKey | ZBSIBCBTLZXEKB-ACCUITESSA-N |
| XLogP | 5.11 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|