C19H14N4OS — CID 25197655
1-benzo[e][1,3]benzothiazol-2-yl-3-[(E)-benzylideneamino]urea (PubChem CID 25197655) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is 1-benzo[e][1,3]benzothiazol-2-yl-3-[(E)-benzylideneamino]urea.
| Compound Name | 1-benzo[e][1,3]benzothiazol-2-yl-3-[(E)-benzylideneamino]urea |
|---|---|
| PubChem CID | 25197655 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-benzo[e][1,3]benzothiazol-2-yl-3-[(E)-benzylideneamino]urea |
| SMILES | O=C(N/N=C/c1ccccc1)Nc1nc2c(ccc3ccccc32)s1 |
| InChI | InChI=1S/C19H14N4OS/c24-18(23-20-12-13-6-2-1-3-7-13)22-19-21-17-15-9-5-4-8-14(15)10-11-16(17)25-19/h1-12H,(H2,21,22,23,24)/b20-12+ |
| InChIKey | RNPOTUFSIQBARX-UDWIEESQSA-N |
| XLogP | 4.61 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|