C21H12N2O3S — CID 5198281
N-benzo[e][1,3]benzothiazol-2-yl-4-oxochromene-3-carboxamide (PubChem CID 5198281) has the molecular formula C21H12N2O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is N-benzo[e][1,3]benzothiazol-2-yl-4-oxochromene-3-carboxamide.
| Compound Name | N-benzo[e][1,3]benzothiazol-2-yl-4-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 5198281 |
| Molecular Formula | C21H12N2O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | N-benzo[e][1,3]benzothiazol-2-yl-4-oxochromene-3-carboxamide |
| SMILES | O=C(Nc1nc2c(ccc3ccccc32)s1)c1coc2ccccc2c1=O |
| InChI | InChI=1S/C21H12N2O3S/c24-19-14-7-3-4-8-16(14)26-11-15(19)20(25)23-21-22-18-13-6-2-1-5-12(13)9-10-17(18)27-21/h1-11H,(H,22,23,25) |
| InChIKey | YNVDZFPMKSPPII-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |