C20H16N2O3S — CID 7202907
4-oxo-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)chromene-3-carboxamide (PubChem CID 7202907) has the molecular formula C20H16N2O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 4-oxo-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)chromene-3-carboxamide.
| Compound Name | 4-oxo-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 7202907 |
| Molecular Formula | C20H16N2O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 4-oxo-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)chromene-3-carboxamide |
| SMILES | CC(C)c1ccc2nc(NC(=O)c3coc4ccccc4c3=O)sc2c1 |
| InChI | InChI=1S/C20H16N2O3S/c1-11(2)12-7-8-15-17(9-12)26-20(21-15)22-19(24)14-10-25-16-6-4-3-5-13(16)18(14)23/h3-11H,1-2H3,(H,21,22,24) |
| InChIKey | ZUEAOHQROAFBAL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |