C19H13N3O4S — CID 4138821
N-(6-acetamido-1,3-benzothiazol-2-yl)-4-oxochromene-3-carboxamide (PubChem CID 4138821) has the molecular formula C19H13N3O4S and a molecular weight of 379.40 g/mol. Its IUPAC name is N-(6-acetamido-1,3-benzothiazol-2-yl)-4-oxochromene-3-carboxamide.
| Compound Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-4-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 4138821 |
| Molecular Formula | C19H13N3O4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | N-(6-acetamido-1,3-benzothiazol-2-yl)-4-oxochromene-3-carboxamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)c3coc4ccccc4c3=O)sc2c1 |
| InChI | InChI=1S/C19H13N3O4S/c1-10(23)20-11-6-7-14-16(8-11)27-19(21-14)22-18(25)13-9-26-15-5-3-2-4-12(15)17(13)24/h2-9H,1H3,(H,20,23)(H,21,22,25) |
| InChIKey | GPWZQQXJXLGEIZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |