C17H14BrClN2O4S2 — CID 112773655
2-bromo-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4,5-dimethoxybenzenesulfonamide (PubChem CID 112773655) has the molecular formula C17H14BrClN2O4S2 and a molecular weight of 489.80 g/mol. Its IUPAC name is 2-bromo-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4,5-dimethoxybenzenesulfonamide.
| Compound Name | 2-bromo-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 112773655 |
| Molecular Formula | C17H14BrClN2O4S2 |
| Molecular Weight | 489.80 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | 2-bromo-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-4,5-dimethoxybenzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc1OC |
| InChI | InChI=1S/C17H14BrClN2O4S2/c1-24-14-7-12(18)16(8-15(14)25-2)27(22,23)21-17-20-13(9-26-17)10-3-5-11(19)6-4-10/h3-9H,1-2H3,(H,20,21) |
| InChIKey | BBVAUNNMRCZOSF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.80 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|