C20H16BrClN2O3S — CID 3596123
3-(3-bromo-4,5-dimethoxyphenyl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 3596123) has the molecular formula C20H16BrClN2O3S and a molecular weight of 479.78 g/mol. Its IUPAC name is 3-(3-bromo-4,5-dimethoxyphenyl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(3-bromo-4,5-dimethoxyphenyl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 3596123 |
| Molecular Formula | C20H16BrClN2O3S |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | 3-(3-bromo-4,5-dimethoxyphenyl)-N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc(-c3ccc(Cl)cc3)cs2)cc(Br)c1OC |
| InChI | InChI=1S/C20H16BrClN2O3S/c1-26-17-10-12(9-15(21)19(17)27-2)3-8-18(25)24-20-23-16(11-28-20)13-4-6-14(22)7-5-13/h3-11H,1-2H3,(H,23,24,25) |
| InChIKey | DDIQNTGESSFVCT-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|