C26H20BrN3O5S — CID 5064176
3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 5064176) has the molecular formula C26H20BrN3O5S and a molecular weight of 566.43 g/mol. Its IUPAC name is 3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 5064176 |
| Molecular Formula | C26H20BrN3O5S |
| Molecular Weight | 566.43 g/mol |
| Exact Mass | 565.03 |
| IUPAC Name | 3-(3-bromo-5-methoxy-4-phenylmethoxyphenyl)-N-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | COc1cc(C=CC(=O)Nc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H20BrN3O5S/c1-34-23-14-18(13-21(27)25(23)35-15-17-5-3-2-4-6-17)7-12-24(31)29-26-28-22(16-36-26)19-8-10-20(11-9-19)30(32)33/h2-14,16H,15H2,1H3,(H,28,29,31) |
| InChIKey | YPWNUEMUIMUPDY-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.43 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|