C15H10ClN3O4S2 — CID 19203678
N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 19203678) has the molecular formula C15H10ClN3O4S2 and a molecular weight of 395.85 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 19203678 |
| Molecular Formula | C15H10ClN3O4S2 |
| Molecular Weight | 395.85 g/mol |
| Exact Mass | 394.98 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)Nc1nc(-c2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C15H10ClN3O4S2/c16-11-7-5-10(6-8-11)12-9-24-15(17-12)18-25(22,23)14-4-2-1-3-13(14)19(20)21/h1-9H,(H,17,18) |
| InChIKey | LSQLRLNLFOSQAJ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|