C20H21N3O4S2 — CID 108782677
N-[[4-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide (PubChem CID 108782677) has the molecular formula C20H21N3O4S2 and a molecular weight of 431.54 g/mol. Its IUPAC name is N-[[4-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide.
| Compound Name | N-[[4-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 108782677 |
| Molecular Formula | C20H21N3O4S2 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N-[[4-[2-[(2-methoxy-5-methylphenyl)sulfonylamino]-1,3-thiazol-4-yl]phenyl]methyl]acetamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1nc(-c2ccc(CNC(C)=O)cc2)cs1 |
| InChI | InChI=1S/C20H21N3O4S2/c1-13-4-9-18(27-3)19(10-13)29(25,26)23-20-22-17(12-28-20)16-7-5-15(6-8-16)11-21-14(2)24/h4-10,12H,11H2,1-3H3,(H,21,24)(H,22,23) |
| InChIKey | JVKOHMBTKQXUQE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'} |
|---|