C31H30N6O5S2 — CID 45258653
N-(4-methoxy-1,3-benzothiazol-2-yl)-4-[[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pyridinyl]amino]benzenesulfonamide (PubChem CID 45258653) has the molecular formula C31H30N6O5S2 and a molecular weight of 630.75 g/mol. Its IUPAC name is N-(4-methoxy-1,3-benzothiazol-2-yl)-4-[[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pyridinyl]amino]benzenesulfonamide.
| Compound Name | N-(4-methoxy-1,3-benzothiazol-2-yl)-4-[[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pyridinyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 45258653 |
| Molecular Formula | C31H30N6O5S2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.17 |
| IUPAC Name | N-(4-methoxy-1,3-benzothiazol-2-yl)-4-[[3-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-2-pyridinyl]amino]benzenesulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3cccnc3Nc3ccc(S(=O)(=O)Nc4nc5c(OC)cccc5s4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H30N6O5S2/c1-41-23-12-10-22(11-13-23)36-17-19-37(20-18-36)30(38)25-5-4-16-32-29(25)33-21-8-14-24(15-9-21)44(39,40)35-31-34-28-26(42-2)6-3-7-27(28)43-31/h3-16H,17-20H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | VMVQYKRIUIFZLR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 125.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|