C16H15N3O4S2 — CID 7599941
2-(benzenesulfonyl)-N'-(4-methoxy-1,3-benzothiazol-2-yl)acetohydrazide (PubChem CID 7599941) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-N'-(4-methoxy-1,3-benzothiazol-2-yl)acetohydrazide.
| Compound Name | 2-(benzenesulfonyl)-N'-(4-methoxy-1,3-benzothiazol-2-yl)acetohydrazide |
|---|---|
| PubChem CID | 7599941 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 2-(benzenesulfonyl)-N'-(4-methoxy-1,3-benzothiazol-2-yl)acetohydrazide |
| SMILES | COc1cccc2sc(NNC(=O)CS(=O)(=O)c3ccccc3)nc12 |
| InChI | InChI=1S/C16H15N3O4S2/c1-23-12-8-5-9-13-15(12)17-16(24-13)19-18-14(20)10-25(21,22)11-6-3-2-4-7-11/h2-9H,10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | XSEYKOHNOVLANM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|