C10H11N3S2 — CID 30032212
(4-ethyl-1,3-benzothiazol-2-yl)thiourea (PubChem CID 30032212) has the molecular formula C10H11N3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is (4-ethyl-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | (4-ethyl-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 30032212 |
| Molecular Formula | C10H11N3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | (4-ethyl-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CCc1cccc2sc(NC(N)=S)nc12 |
| InChI | InChI=1S/C10H11N3S2/c1-2-6-4-3-5-7-8(6)12-10(15-7)13-9(11)14/h3-5H,2H2,1H3,(H3,11,12,13,14) |
| InChIKey | KKOZFPWSSCAWAU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|