C12H15N3S2 — CID 43866579
(4-butan-2-yl-1,3-benzothiazol-2-yl)thiourea (PubChem CID 43866579) has the molecular formula C12H15N3S2 and a molecular weight of 265.41 g/mol. Its IUPAC name is (4-butan-2-yl-1,3-benzothiazol-2-yl)thiourea.
| Compound Name | (4-butan-2-yl-1,3-benzothiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 43866579 |
| Molecular Formula | C12H15N3S2 |
| Molecular Weight | 265.41 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (4-butan-2-yl-1,3-benzothiazol-2-yl)thiourea |
| SMILES | CCC(C)c1cccc2sc(NC(N)=S)nc12 |
| InChI | InChI=1S/C12H15N3S2/c1-3-7(2)8-5-4-6-9-10(8)14-12(17-9)15-11(13)16/h4-7H,3H2,1-2H3,(H3,13,14,15,16) |
| InChIKey | UTWNMGRTJDHLQW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|