C22H18N2O2S — CID 41235420
N-(4-ethyl-1,3-benzothiazol-2-yl)-3-phenoxybenzamide (PubChem CID 41235420) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is N-(4-ethyl-1,3-benzothiazol-2-yl)-3-phenoxybenzamide.
| Compound Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-3-phenoxybenzamide |
|---|---|
| PubChem CID | 41235420 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-(4-ethyl-1,3-benzothiazol-2-yl)-3-phenoxybenzamide |
| SMILES | CCc1cccc2sc(NC(=O)c3cccc(Oc4ccccc4)c3)nc12 |
| InChI | InChI=1S/C22H18N2O2S/c1-2-15-8-7-13-19-20(15)23-22(27-19)24-21(25)16-9-6-12-18(14-16)26-17-10-4-3-5-11-17/h3-14H,2H2,1H3,(H,23,24,25) |
| InChIKey | NHXPZEOTDSIODM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |