C14H11N3O2S2 — CID 144699528
4-[(2-amino-1,3-benzothiazol-4-yl)sulfanylamino]benzoic acid (PubChem CID 144699528) has the molecular formula C14H11N3O2S2 and a molecular weight of 317.40 g/mol. Its IUPAC name is 4-[(2-amino-1,3-benzothiazol-4-yl)sulfanylamino]benzoic acid.
| Compound Name | 4-[(2-amino-1,3-benzothiazol-4-yl)sulfanylamino]benzoic acid |
|---|---|
| PubChem CID | 144699528 |
| Molecular Formula | C14H11N3O2S2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 4-[(2-amino-1,3-benzothiazol-4-yl)sulfanylamino]benzoic acid |
| SMILES | Nc1nc2c(SNc3ccc(C(=O)O)cc3)cccc2s1 |
| InChI | InChI=1S/C14H11N3O2S2/c15-14-16-12-10(20-14)2-1-3-11(12)21-17-9-6-4-8(5-7-9)13(18)19/h1-7,17H,(H2,15,16)(H,18,19) |
| InChIKey | WIGCJXMWWZPQKB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|