C26H23N5O2S — CID 134545155
[4-(pyridine-4-carbonyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 134545155) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is [4-(pyridine-4-carbonyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-(pyridine-4-carbonyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 134545155 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [4-(pyridine-4-carbonyl)piperazin-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccncc1)N1CCN(C(=O)c2ccc(NSc3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C26H23N5O2S/c32-25(30-15-17-31(18-16-30)26(33)21-10-13-27-14-11-21)20-6-8-22(9-7-20)29-34-23-5-1-3-19-4-2-12-28-24(19)23/h1-14,29H,15-18H2 |
| InChIKey | UDOBDJKCSOVFLT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|