C28H27ClN4O2S — CID 146321630
[4-[(5-chloro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 146321630) has the molecular formula C28H27ClN4O2S and a molecular weight of 519.07 g/mol. Its IUPAC name is [4-[(5-chloro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(5-chloro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 146321630 |
| Molecular Formula | C28H27ClN4O2S |
| Molecular Weight | 519.07 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | [4-[(5-chloro-2-hydroxyphenyl)methyl]-1,4-diazepan-1-yl]-[4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3cccnc23)cc1)N1CCCN(Cc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C28H27ClN4O2S/c29-23-9-12-25(34)22(18-23)19-32-14-3-15-33(17-16-32)28(35)21-7-10-24(11-8-21)31-36-26-6-1-4-20-5-2-13-30-27(20)26/h1-2,4-13,18,31,34H,3,14-17,19H2 |
| InChIKey | XMUTVKUJCNAYNC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.07 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|