C27H26ClN5O2S — CID 134545315
[4-[(3-chloro-4-pyridinyl)methyl]piperazin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 134545315) has the molecular formula C27H26ClN5O2S and a molecular weight of 520.06 g/mol. Its IUPAC name is [4-[(3-chloro-4-pyridinyl)methyl]piperazin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-[(3-chloro-4-pyridinyl)methyl]piperazin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 134545315 |
| Molecular Formula | C27H26ClN5O2S |
| Molecular Weight | 520.06 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | [4-[(3-chloro-4-pyridinyl)methyl]piperazin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CCN(Cc3ccncc3Cl)CC2)ccc1NSc1cccc2cccnc12 |
| InChI | InChI=1S/C27H26ClN5O2S/c1-35-24-16-20(7-8-23(24)31-36-25-6-2-4-19-5-3-10-30-26(19)25)27(34)33-14-12-32(13-15-33)18-21-9-11-29-17-22(21)28/h2-11,16-17,31H,12-15,18H2,1H3 |
| InChIKey | LTNQJSGYEMFYIX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.06 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|