C27H25N3O4S — CID 123263850
[3-(2-methoxyphenoxy)azetidin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 123263850) has the molecular formula C27H25N3O4S and a molecular weight of 487.58 g/mol. Its IUPAC name is [3-(2-methoxyphenoxy)azetidin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [3-(2-methoxyphenoxy)azetidin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 123263850 |
| Molecular Formula | C27H25N3O4S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | [3-(2-methoxyphenoxy)azetidin-1-yl]-[3-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CC(Oc3ccccc3OC)C2)ccc1NSc1cccc2cccnc12 |
| InChI | InChI=1S/C27H25N3O4S/c1-32-22-9-3-4-10-23(22)34-20-16-30(17-20)27(31)19-12-13-21(24(15-19)33-2)29-35-25-11-5-7-18-8-6-14-28-26(18)25/h3-15,20,29H,16-17H2,1-2H3 |
| InChIKey | FXRAYJJHIAYTOV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|