C26H22ClN5O2S — CID 129042634
[3-chloro-4-(quinolin-8-ylsulfanylamino)phenyl]-[4-(pyridine-2-carbonyl)piperazin-1-yl]methanone (PubChem CID 129042634) has the molecular formula C26H22ClN5O2S and a molecular weight of 504.02 g/mol. Its IUPAC name is [3-chloro-4-(quinolin-8-ylsulfanylamino)phenyl]-[4-(pyridine-2-carbonyl)piperazin-1-yl]methanone.
| Compound Name | [3-chloro-4-(quinolin-8-ylsulfanylamino)phenyl]-[4-(pyridine-2-carbonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129042634 |
| Molecular Formula | C26H22ClN5O2S |
| Molecular Weight | 504.02 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | [3-chloro-4-(quinolin-8-ylsulfanylamino)phenyl]-[4-(pyridine-2-carbonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(NSc2cccc3cccnc23)c(Cl)c1)N1CCN(C(=O)c2ccccn2)CC1 |
| InChI | InChI=1S/C26H22ClN5O2S/c27-20-17-19(9-10-21(20)30-35-23-8-3-5-18-6-4-12-29-24(18)23)25(33)31-13-15-32(16-14-31)26(34)22-7-1-2-11-28-22/h1-12,17,30H,13-16H2 |
| InChIKey | PIBDQDLZXMCOFX-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.02 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|