C28H24F2N4O3S — CID 129042741
(3,4-difluorophenyl)-[4-[2-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazin-1-yl]methanone (PubChem CID 129042741) has the molecular formula C28H24F2N4O3S and a molecular weight of 534.59 g/mol. Its IUPAC name is (3,4-difluorophenyl)-[4-[2-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazin-1-yl]methanone.
| Compound Name | (3,4-difluorophenyl)-[4-[2-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 129042741 |
| Molecular Formula | C28H24F2N4O3S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | (3,4-difluorophenyl)-[4-[2-methoxy-4-(quinolin-8-ylsulfanylamino)benzoyl]piperazin-1-yl]methanone |
| SMILES | COc1cc(NSc2cccc3cccnc23)ccc1C(=O)N1CCN(C(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C28H24F2N4O3S/c1-37-24-17-20(32-38-25-6-2-4-18-5-3-11-31-26(18)25)8-9-21(24)28(36)34-14-12-33(13-15-34)27(35)19-7-10-22(29)23(30)16-19/h2-11,16-17,32H,12-15H2,1H3 |
| InChIKey | IOLBHITTZLEPDP-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|