C27H27N5O2S — CID 146321560
[4-(2-methoxyphenyl)-1,4-diazepan-1-yl]-[5-(quinolin-8-ylsulfanylamino)-2-pyridinyl]methanone (PubChem CID 146321560) has the molecular formula C27H27N5O2S and a molecular weight of 485.61 g/mol. Its IUPAC name is [4-(2-methoxyphenyl)-1,4-diazepan-1-yl]-[5-(quinolin-8-ylsulfanylamino)-2-pyridinyl]methanone.
| Compound Name | [4-(2-methoxyphenyl)-1,4-diazepan-1-yl]-[5-(quinolin-8-ylsulfanylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 146321560 |
| Molecular Formula | C27H27N5O2S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | [4-(2-methoxyphenyl)-1,4-diazepan-1-yl]-[5-(quinolin-8-ylsulfanylamino)-2-pyridinyl]methanone |
| SMILES | COc1ccccc1N1CCCN(C(=O)c2ccc(NSc3cccc4cccnc34)cn2)CC1 |
| InChI | InChI=1S/C27H27N5O2S/c1-34-24-10-3-2-9-23(24)31-15-6-16-32(18-17-31)27(33)22-13-12-21(19-29-22)30-35-25-11-4-7-20-8-5-14-28-26(20)25/h2-5,7-14,19,30H,6,15-18H2,1H3 |
| InChIKey | CNZJTCCEXWJOPN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|