C28H27N5O4S — CID 121290803
[4-(3-methoxypyridine-4-carbonyl)piperazin-1-yl]-[2-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone (PubChem CID 121290803) has the molecular formula C28H27N5O4S and a molecular weight of 529.62 g/mol. Its IUPAC name is [4-(3-methoxypyridine-4-carbonyl)piperazin-1-yl]-[2-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone.
| Compound Name | [4-(3-methoxypyridine-4-carbonyl)piperazin-1-yl]-[2-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
|---|---|
| PubChem CID | 121290803 |
| Molecular Formula | C28H27N5O4S |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.18 |
| IUPAC Name | [4-(3-methoxypyridine-4-carbonyl)piperazin-1-yl]-[2-methoxy-4-(quinolin-8-ylsulfanylamino)phenyl]methanone |
| SMILES | COc1cnccc1C(=O)N1CCN(C(=O)c2ccc(NSc3cccc4cccnc34)cc2OC)CC1 |
| InChI | InChI=1S/C28H27N5O4S/c1-36-23-17-20(31-38-25-7-3-5-19-6-4-11-30-26(19)25)8-9-21(23)27(34)32-13-15-33(16-14-32)28(35)22-10-12-29-18-24(22)37-2/h3-12,17-18,31H,13-16H2,1-2H3 |
| InChIKey | FGJJDNXLSAHXCU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|