C20H19N3O5S — CID 57383048
N-[4-(3-hydroxyazetidine-1-carbonyl)-3-methoxyphenyl]quinoline-8-sulfonamide (PubChem CID 57383048) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is N-[4-(3-hydroxyazetidine-1-carbonyl)-3-methoxyphenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-(3-hydroxyazetidine-1-carbonyl)-3-methoxyphenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 57383048 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | N-[4-(3-hydroxyazetidine-1-carbonyl)-3-methoxyphenyl]quinoline-8-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccc3cccnc23)ccc1C(=O)N1CC(O)C1 |
| InChI | InChI=1S/C20H19N3O5S/c1-28-17-10-14(7-8-16(17)20(25)23-11-15(24)12-23)22-29(26,27)18-6-2-4-13-5-3-9-21-19(13)18/h2-10,15,22,24H,11-12H2,1H3 |
| InChIKey | AXXXMERACAUBKT-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |