C28H34N4O4S — CID 67505073
N-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]-3-methoxyphenyl]quinoline-8-sulfonamide (PubChem CID 67505073) has the molecular formula C28H34N4O4S and a molecular weight of 522.67 g/mol. Its IUPAC name is N-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]-3-methoxyphenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]-3-methoxyphenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 67505073 |
| Molecular Formula | C28H34N4O4S |
| Molecular Weight | 522.67 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | N-[4-[4-(cyclohexylmethyl)piperazine-1-carbonyl]-3-methoxyphenyl]quinoline-8-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccc3cccnc23)ccc1C(=O)N1CCN(CC2CCCCC2)CC1 |
| InChI | InChI=1S/C28H34N4O4S/c1-36-25-19-23(30-37(34,35)26-11-5-9-22-10-6-14-29-27(22)26)12-13-24(25)28(33)32-17-15-31(16-18-32)20-21-7-3-2-4-8-21/h5-6,9-14,19,21,30H,2-4,7-8,15-18,20H2,1H3 |
| InChIKey | YHVCAEGJKVZVSS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |