C29H30N4O5S — CID 174842433
N-[4-[(2R)-4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 174842433) has the molecular formula C29H30N4O5S and a molecular weight of 546.65 g/mol. Its IUPAC name is N-[4-[(2R)-4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[(2R)-4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 174842433 |
| Molecular Formula | C29H30N4O5S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N-[4-[(2R)-4-(3,4-dimethoxyphenyl)-2-methylpiperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc3)[C@H](C)C2)cc1OC |
| InChI | InChI=1S/C29H30N4O5S/c1-20-19-32(24-13-14-25(37-2)26(18-24)38-3)16-17-33(20)29(34)22-9-11-23(12-10-22)31-39(35,36)27-8-4-6-21-7-5-15-30-28(21)27/h4-15,18,20,31H,16-17,19H2,1-3H3/t20-/m1/s1 |
| InChIKey | ANVSTCKYSDSAPV-HXUWFJFHSA-N |
| XLogP | 4.40 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|