C29H27F3N4O6S — CID 174841950
N-[4-[4-(3,4-dimethoxyphenyl)piperazine-1-carbonyl]-2-(trifluoromethoxy)phenyl]quinoline-8-sulfonamide (PubChem CID 174841950) has the molecular formula C29H27F3N4O6S and a molecular weight of 616.62 g/mol. Its IUPAC name is N-[4-[4-(3,4-dimethoxyphenyl)piperazine-1-carbonyl]-2-(trifluoromethoxy)phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-(3,4-dimethoxyphenyl)piperazine-1-carbonyl]-2-(trifluoromethoxy)phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 174841950 |
| Molecular Formula | C29H27F3N4O6S |
| Molecular Weight | 616.62 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | N-[4-[4-(3,4-dimethoxyphenyl)piperazine-1-carbonyl]-2-(trifluoromethoxy)phenyl]quinoline-8-sulfonamide |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)c(OC(F)(F)F)c3)CC2)cc1OC |
| InChI | InChI=1S/C29H27F3N4O6S/c1-40-23-11-9-21(18-25(23)41-2)35-13-15-36(16-14-35)28(37)20-8-10-22(24(17-20)42-29(30,31)32)34-43(38,39)26-7-3-5-19-6-4-12-33-27(19)26/h3-12,17-18,34H,13-16H2,1-2H3 |
| InChIKey | JNWGPSMXCOBXJK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|