C29H31N5O6S — CID 134404548
N-[2-methoxy-4-[4-[(E)-2-[(E)-2-methoxy-2-(methylideneamino)ethenyl]but-2-enoyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 134404548) has the molecular formula C29H31N5O6S and a molecular weight of 577.66 g/mol. Its IUPAC name is N-[2-methoxy-4-[4-[(E)-2-[(E)-2-methoxy-2-(methylideneamino)ethenyl]but-2-enoyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[2-methoxy-4-[4-[(E)-2-[(E)-2-methoxy-2-(methylideneamino)ethenyl]but-2-enoyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 134404548 |
| Molecular Formula | C29H31N5O6S |
| Molecular Weight | 577.66 g/mol |
| Exact Mass | 577.20 |
| IUPAC Name | N-[2-methoxy-4-[4-[(E)-2-[(E)-2-methoxy-2-(methylideneamino)ethenyl]but-2-enoyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | C=N/C(=C\C(=C/C)C(=O)N1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)c(OC)c2)CC1)OC |
| InChI | InChI=1S/C29H31N5O6S/c1-5-20(19-26(30-2)40-4)28(35)33-14-16-34(17-15-33)29(36)22-11-12-23(24(18-22)39-3)32-41(37,38)25-10-6-8-21-9-7-13-31-27(21)25/h5-13,18-19,32H,2,14-17H2,1,3-4H3/b20-5+,26-19+ |
| InChIKey | LYUNZEOZPBMHJB-BYRXQMFMSA-N |
| XLogP | 3.46 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.66 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|