C27H28FN5O3S — CID 134404549
N-[2-fluoro-4-[4-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 134404549) has the molecular formula C27H28FN5O3S and a molecular weight of 521.62 g/mol. Its IUPAC name is N-[2-fluoro-4-[4-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[2-fluoro-4-[4-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 134404549 |
| Molecular Formula | C27H28FN5O3S |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | N-[2-fluoro-4-[4-[(2Z,4Z)-2-(methylideneamino)hexa-2,4-dienyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | C=N/C(=C\C=C/C)CN1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)c(F)c2)CC1 |
| InChI | InChI=1S/C27H28FN5O3S/c1-3-4-9-22(29-2)19-32-14-16-33(17-15-32)27(34)21-11-12-24(23(28)18-21)31-37(35,36)25-10-5-7-20-8-6-13-30-26(20)25/h3-13,18,31H,2,14-17,19H2,1H3/b4-3-,22-9- |
| InChIKey | RCBCUYZUIBSRDK-VWROYIRRSA-N |
| XLogP | 4.09 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|