C28H27FN4O3S — CID 67504796
N-[4-(4-benzyl-1,4-diazepane-1-carbonyl)-2-fluorophenyl]quinoline-8-sulfonamide (PubChem CID 67504796) has the molecular formula C28H27FN4O3S and a molecular weight of 518.61 g/mol. Its IUPAC name is N-[4-(4-benzyl-1,4-diazepane-1-carbonyl)-2-fluorophenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-(4-benzyl-1,4-diazepane-1-carbonyl)-2-fluorophenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 67504796 |
| Molecular Formula | C28H27FN4O3S |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | N-[4-(4-benzyl-1,4-diazepane-1-carbonyl)-2-fluorophenyl]quinoline-8-sulfonamide |
| SMILES | O=C(c1ccc(NS(=O)(=O)c2cccc3cccnc23)c(F)c1)N1CCCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C28H27FN4O3S/c29-24-19-23(28(34)33-16-6-15-32(17-18-33)20-21-7-2-1-3-8-21)12-13-25(24)31-37(35,36)26-11-4-9-22-10-5-14-30-27(22)26/h1-5,7-14,19,31H,6,15-18,20H2 |
| InChIKey | KKCNYDRZRKQNNM-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |