C29H28N4O5S — CID 59635188
ethyl 3-[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazin-1-yl]benzoate (PubChem CID 59635188) has the molecular formula C29H28N4O5S and a molecular weight of 544.63 g/mol. Its IUPAC name is ethyl 3-[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazin-1-yl]benzoate.
| Compound Name | ethyl 3-[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazin-1-yl]benzoate |
|---|---|
| PubChem CID | 59635188 |
| Molecular Formula | C29H28N4O5S |
| Molecular Weight | 544.63 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | ethyl 3-[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc3)CC2)c1 |
| InChI | InChI=1S/C29H28N4O5S/c1-2-38-29(35)23-7-3-9-25(20-23)32-16-18-33(19-17-32)28(34)22-11-13-24(14-12-22)31-39(36,37)26-10-4-6-21-8-5-15-30-27(21)26/h3-15,20,31H,2,16-19H2,1H3 |
| InChIKey | KBUKHPLVWFZJNI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |