C29H26N4O6S — CID 129293656
N-[4-[4-(3-formyl-2-methoxybenzoyl)piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 129293656) has the molecular formula C29H26N4O6S and a molecular weight of 558.62 g/mol. Its IUPAC name is N-[4-[4-(3-formyl-2-methoxybenzoyl)piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-(3-formyl-2-methoxybenzoyl)piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 129293656 |
| Molecular Formula | C29H26N4O6S |
| Molecular Weight | 558.62 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[4-[4-(3-formyl-2-methoxybenzoyl)piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | COc1c(C=O)cccc1C(=O)N1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C29H26N4O6S/c1-39-27-22(19-34)6-2-8-24(27)29(36)33-17-15-32(16-18-33)28(35)21-10-12-23(13-11-21)31-40(37,38)25-9-3-5-20-7-4-14-30-26(20)25/h2-14,19,31H,15-18H2,1H3 |
| InChIKey | IJOGSYPWQQMNOH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|