C30H32N4O6S — CID 59634877
N-[4-[4-[(2-hydroxy-3,4-dimethoxy-6-methylphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide (PubChem CID 59634877) has the molecular formula C30H32N4O6S and a molecular weight of 576.68 g/mol. Its IUPAC name is N-[4-[4-[(2-hydroxy-3,4-dimethoxy-6-methylphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide.
| Compound Name | N-[4-[4-[(2-hydroxy-3,4-dimethoxy-6-methylphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 59634877 |
| Molecular Formula | C30H32N4O6S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.20 |
| IUPAC Name | N-[4-[4-[(2-hydroxy-3,4-dimethoxy-6-methylphenyl)methyl]piperazine-1-carbonyl]phenyl]quinoline-8-sulfonamide |
| SMILES | COc1cc(C)c(CN2CCN(C(=O)c3ccc(NS(=O)(=O)c4cccc5cccnc45)cc3)CC2)c(O)c1OC |
| InChI | InChI=1S/C30H32N4O6S/c1-20-18-25(39-2)29(40-3)28(35)24(20)19-33-14-16-34(17-15-33)30(36)22-9-11-23(12-10-22)32-41(37,38)26-8-4-6-21-7-5-13-31-27(21)26/h4-13,18,32,35H,14-17,19H2,1-3H3 |
| InChIKey | ZQBIIIPOQNKZKF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 121.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|