C27H29N5O6S — CID 163740658
ethenyl 4-[[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carbonyl]amino]butanoate (PubChem CID 163740658) has the molecular formula C27H29N5O6S and a molecular weight of 551.63 g/mol. Its IUPAC name is ethenyl 4-[[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carbonyl]amino]butanoate.
| Compound Name | ethenyl 4-[[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 163740658 |
| Molecular Formula | C27H29N5O6S |
| Molecular Weight | 551.63 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | ethenyl 4-[[4-[4-(quinolin-8-ylsulfonylamino)benzoyl]piperazine-1-carbonyl]amino]butanoate |
| SMILES | C=COC(=O)CCCNC(=O)N1CCN(C(=O)c2ccc(NS(=O)(=O)c3cccc4cccnc34)cc2)CC1 |
| InChI | InChI=1S/C27H29N5O6S/c1-2-38-24(33)9-5-15-29-27(35)32-18-16-31(17-19-32)26(34)21-10-12-22(13-11-21)30-39(36,37)23-8-3-6-20-7-4-14-28-25(20)23/h2-4,6-8,10-14,30H,1,5,9,15-19H2,(H,29,35) |
| InChIKey | LHLFFJZMGAYHNK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 138.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.63 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|